cas: 109180-95-2 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate, 99%, 99% (CAS 109180-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBAP-100mg |
| cas | 109180-95-2 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 832.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate (CAS 109180-95-2) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: tert-butyl (2S)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate. InChIKey: SHPVYSDLQWCDJP-JTQLQIEISA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | tert-butyl (2S)-2-(3-ethoxy-3-oxopropanoyl)pyrrolidine-1-carboxylate |
| InChIKey | SHPVYSDLQWCDJP-JTQLQIEISA-N |
| SMILES | CCOC(=O)CC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)