cas: 108149-65-1 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 4-(hydroxymethyl)-2,2-dimethyloxazolidine-3-carboxylate, 97%, 97% (CAS 108149-65-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UF4-100mg |
| cas | 108149-65-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 717.20 Pln | |
| Chemat | 50g | 1336.40 Pln | |
| Chemat | 100g | 2541.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 108149-65-1) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: DWFOEHLGMZJBAA-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl (4S)-4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | DWFOEHLGMZJBAA-QMMMGPOBSA-N |
| SMILES | CC1(N([C@H](CO1)CO)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)