Products 136092-78-9

CAS 136092-78-9 appears in our catalog under these names: Boc-n-me-nva-oh, 98%, Boc-N-Me-Nva-OH 95%, (S)-2-((tert-Butoxycarbonyl)(methyl)amino)pentanoic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (CAS 136092-78-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid. InChIKey: BSMXBPUTGXWAGA-QMMMGPOBSA-N.

Identity
Molecular formulaC11H21NO4
Molecular weight231.29 g/mol
IUPAC name(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid
InChIKeyBSMXBPUTGXWAGA-QMMMGPOBSA-N
SMILESCCC[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)