Products 55674-63-0

CAS 55674-63-0 appears in our catalog under these names: Boc-D-Nle-OH, 98%, Boc–D–Nle–OH, Boc-D-Nle-OH, Boc-D-norleucine, 96%, 96%, Boc-D-norleucine, 99.98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg, 100 g, 5 g.

Structural formula: {0} (CAS {1})

(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 55674-63-0) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: ZIOCIQJXEKFHJO-MRVPVSSYSA-N.

Identity
Molecular formulaC11H21NO4
Molecular weight231.29 g/mol
IUPAC name(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
InChIKeyZIOCIQJXEKFHJO-MRVPVSSYSA-N
SMILESCCCC[C@H](C(=O)O)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)