CAS 1190044-29-1 is the registry number for tert-Butyl ((4-hydroxy-1,1-dioxidotetrahydro-2H-thiopyran-4-yl)methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4-hydroxy-1,1-dioxothian-4-yl)methyl]carbamate (CAS 1190044-29-1) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl N-[(4-hydroxy-1,1-dioxothian-4-yl)methyl]carbamate. InChIKey: SOMURMXVLIJZIL-UHFFFAOYSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl N-[(4-hydroxy-1,1-dioxothian-4-yl)methyl]carbamate |
| InChIKey | SOMURMXVLIJZIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CCS(=O)(=O)CC1)O |
Computed by PubChem (NCBI)