Products 1394239-78-1
CAS 1394239-78-1 is the registry number for tert-Butyl (S)-4-((S)-sec-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-butan-2-yl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1394239-78-1) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl 4-butan-2-yl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: NKCHQSLMZGURIG-UHFFFAOYSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl 4-butan-2-yl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | NKCHQSLMZGURIG-UHFFFAOYSA-N |
| SMILES | CCC(C)C1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)