cas: 1206227-46-4 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 4-isopropyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98% (CAS 1206227-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A713477-100mg |
| cas | 1206227-46-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 467.11 Pln | |
| AmBeed | 250mg | 551.74 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 3736.20 Pln | |
| Fluorochem | 10g | 5532.44 Pln | |
| Fluorochem | 25g | 6782.00 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (4S)-2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate (CAS 1206227-46-4) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl (4S)-2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate. InChIKey: FWEXSIHWPAKSOP-MRVPVSSYSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl (4S)-2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate |
| InChIKey | FWEXSIHWPAKSOP-MRVPVSSYSA-N |
| SMILES | CC(C)[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)