CAS 1781137-76-5 appears in our catalog under these names: tert-Butyl ((3-hydroxy-1,1-dioxidotetrahydrothiophen-3-yl)methyl)carbamate, 98%, tert-Butyl N-((3-hydroxy-1,1-dioxo-1λâ¶-thiolan-3-yl)methyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
Tert-butyl N-[(3-hydroxy-1,1-dioxothiolan-3-yl)methyl]carbamate (CAS 1781137-76-5) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl N-[(3-hydroxy-1,1-dioxothiolan-3-yl)methyl]carbamate. InChIKey: YOVFPDKVAGJDQE-UHFFFAOYSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl N-[(3-hydroxy-1,1-dioxothiolan-3-yl)methyl]carbamate |
| InChIKey | YOVFPDKVAGJDQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CCS(=O)(=O)C1)O |
Computed by PubChem (NCBI)