Products 278788-71-9
CAS 278788-71-9 appears in our catalog under these names: tert-Butyl 2-(hydroxymethyl)thiomorpholine-4-carboxylate 1,1-dioxide, 95%, tert–butyl 2–(hydroxymethyl)thiomorpholine–4–carboxylate 1，1–dioxide. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl 2-(hydroxymethyl)-1,1-dioxo-1,4-thiazinane-4-carboxylate (CAS 278788-71-9) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl 2-(hydroxymethyl)-1,1-dioxo-1,4-thiazinane-4-carboxylate. InChIKey: XNHSBQOBPOGGFW-UHFFFAOYSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl 2-(hydroxymethyl)-1,1-dioxo-1,4-thiazinane-4-carboxylate |
| InChIKey | XNHSBQOBPOGGFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)C(C1)CO |
Computed by PubChem (NCBI)