cas: 69611-01-4 — see every product listed under this CAS number, including other names
(Z)-2-(But-2-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 69611-01-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620197-100MG |
| cas | 69611-01-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2486.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[(Z)-but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69611-01-4) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-[(Z)-but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ARSSMJZIAKUXEW-SREVYHEPSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-[(Z)-but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ARSSMJZIAKUXEW-SREVYHEPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C/C=C\C |
Computed by PubChem (NCBI)