Products 167773-10-6
CAS 167773-10-6 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(2-methylallyl)-1,3,2-dioxaborolane, 95-<97%, 4,4,5,5-Tetramethyl-2-(2-methylallyl)-1,3,2-dioxaborolane, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
4,4,5,5-tetramethyl-2-(2-methylprop-2-enyl)-1,3,2-dioxaborolane (CAS 167773-10-6) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylprop-2-enyl)-1,3,2-dioxaborolane. InChIKey: LLUSJINKGBXOIN-UHFFFAOYSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylprop-2-enyl)-1,3,2-dioxaborolane |
| InChIKey | LLUSJINKGBXOIN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC(=C)C |
Computed by PubChem (NCBI)