CAS 69611-01-4 appears in our catalog under these names: Cis-2-buten-1-ylboronic acid, pinacol ester, 95%, (Z)-2-(But-2-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95%, CIS-CROTYLBORONIC ACID PINACOL ESTER, 97, (Z)-2-(But-2-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-[(Z)-but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69611-01-4) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-[(Z)-but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ARSSMJZIAKUXEW-SREVYHEPSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-[(Z)-but-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ARSSMJZIAKUXEW-SREVYHEPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C/C=C\C |
Computed by PubChem (NCBI)