CAS 91890-02-7 is the registry number for 4,4,5,5-Tetramethyl-2-((1E)-1-methyl-1-propen-1-yl)-1,3,2-dioxaborolane. Offered by: TRC. Available pack sizes: 2,5g.
2-[(E)-but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 91890-02-7) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-[(E)-but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HEZPWTQUZJEVQF-FPLPWBNLSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-[(E)-but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HEZPWTQUZJEVQF-FPLPWBNLSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C\C)/C |
Computed by PubChem (NCBI)