Products 75851-67-1
CAS 75851-67-1 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolane-2-yl)-but-1-ene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-but-3-en-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 75851-67-1) is a chemical compound with the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. IUPAC name: 2-but-3-en-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KWHFZFUCSIXXFF-UHFFFAOYSA-N.
| Molecular formula | C10H19BO2 |
|---|---|
| Molecular weight | 182.07 g/mol |
| IUPAC name | 2-but-3-en-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KWHFZFUCSIXXFF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C=C |
Computed by PubChem (NCBI)