cas: 148257-14-1 — see every product listed under this CAS number, including other names
(exo,exo)-3-((tert-Butoxycarbonyl)amino)-7-oxabicyclo(2.2.1)hept-5-ene-2-carboxylic acid, 97% (CAS 148257-14-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A249835-5g |
| cas | 148257-14-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17588.41 Pln | |
| AmBeed | 100mg | 1085.56 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,2S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS 148257-14-1) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: (1R,2S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid. InChIKey: BDISLHPIKVZWDN-XAVMHZPKSA-N.
| Molecular formula | C12H17NO5 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| InChIKey | BDISLHPIKVZWDN-XAVMHZPKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@@H]2C=C[C@H]([C@H]1C(=O)O)O2 |
Computed by PubChem (NCBI)