Products 34841-00-4

CAS 34841-00-4 is the registry number for 3-Amino-3-(3,4,5-trimethoxyphenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-amino-3-(3,4,5-trimethoxyphenyl)propanoic acid (CAS 34841-00-4) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: 3-amino-3-(3,4,5-trimethoxyphenyl)propanoic acid. InChIKey: UMIWUEOAUPOOEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5
Molecular weight255.27 g/mol
IUPAC name3-amino-3-(3,4,5-trimethoxyphenyl)propanoic acid
InChIKeyUMIWUEOAUPOOEJ-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(CC(=O)O)N

Computed by PubChem (NCBI)