Products 889089-00-3

CAS 889089-00-3 is the registry number for Ethyl 3-(tert-butoxycarbonylamino)furan-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]furan-2-carboxylate (CAS 889089-00-3) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]furan-2-carboxylate. InChIKey: CXHHYRFAVOKTQD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5
Molecular weight255.27 g/mol
IUPAC nameethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]furan-2-carboxylate
InChIKeyCXHHYRFAVOKTQD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CO1)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)