CAS 210557-95-2 appears in our catalog under these names: Ac-Tyr-OMe H2O, 98%, (S)-Methyl 2-acetamido-3-(4-hydroxyphenyl)propanoate hydrate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 1g, 5g.
Methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate (CAS 210557-95-2) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate. InChIKey: PGFUTSKWMKEEKA-MERQFXBCSA-N.
| Molecular formula | C12H17NO5 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | methyl (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate;hydrate |
| InChIKey | PGFUTSKWMKEEKA-MERQFXBCSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)OC.O |
Computed by PubChem (NCBI)