Products 127464-43-1
CAS 127464-43-1 appears in our catalog under these names: Butanedioic acid 2-ethyl-6-methyl-3-pyridinol (1:1), >95% (HPLC), 2-Ethyl-6-methylpyridin-3-ol succinate, 97%, Emoxypine Succinate, Emoxypine succinate, 2-Ethyl-3-hydroxy-6-methylpyridine Succinate, >98.0%(T). Offered by: TRC, Combi-blocks, TargetMol, GLPBio, TCI. Available pack sizes: 2,5g, 5g, 25g, 100g, 1g, 10g, 500g, 500 mg.
Butanedioic acid;2-ethyl-6-methylpyridin-3-ol (CAS 127464-43-1) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: butanedioic acid;2-ethyl-6-methylpyridin-3-ol. InChIKey: IKMNOGHPKNFPTK-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | butanedioic acid;2-ethyl-6-methylpyridin-3-ol |
| InChIKey | IKMNOGHPKNFPTK-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=N1)C)O.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)