CAS 1065663-52-6 appears in our catalog under these names: [1,1':3',1''-Terphenyl]-2'-ylboronic acid, 95%, 95%, [1,1':3',1''-Terphenyl]-2'-ylboronic acid, 98%, [1,1':3',1''-Terphenyl]-2'-ylboronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2,6-diphenylphenyl)boronic acid (CAS 1065663-52-6) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: (2,6-diphenylphenyl)boronic acid. InChIKey: LHZVACLBKORXAF-UHFFFAOYSA-N.
| Molecular formula | C18H15BO2 |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | (2,6-diphenylphenyl)boronic acid |
| InChIKey | LHZVACLBKORXAF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C2=CC=CC=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)