CAS 1133796-50-5 is the registry number for [1,1':3',1''-Terphenyl]-2-ylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
[2-(3-phenylphenyl)phenyl]boronic acid (CAS 1133796-50-5) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: [2-(3-phenylphenyl)phenyl]boronic acid. InChIKey: XIZLXGRTCCYWCE-UHFFFAOYSA-N.
| Molecular formula | C18H15BO2 |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | [2-(3-phenylphenyl)phenyl]boronic acid |
| InChIKey | XIZLXGRTCCYWCE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC=CC(=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)