Products 877993-09-4
CAS 877993-09-4 appears in our catalog under these names: 4-(4-BIPHENYL)PHENYL BORONIC ACID, 97%, [1,1':4',1''-Terphenyl]-4-ylboronic acid, 97%, 97%, PPP-BA, 97%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
[4-(4-phenylphenyl)phenyl]boronic acid (CAS 877993-09-4) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: [4-(4-phenylphenyl)phenyl]boronic acid. InChIKey: UAYHYNNEZRKUSH-UHFFFAOYSA-N.
| Molecular formula | C18H15BO2 |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | [4-(4-phenylphenyl)phenyl]boronic acid |
| InChIKey | UAYHYNNEZRKUSH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)