Products 1191061-81-0

CAS 1191061-81-0 is the registry number for [1,1':3',1''-Terphenyl]-4-ylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[4-(3-phenylphenyl)phenyl]boronic acid (CAS 1191061-81-0) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: [4-(3-phenylphenyl)phenyl]boronic acid. InChIKey: DGIXQQRYMQRZBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15BO2
Molecular weight274.1 g/mol
IUPAC name[4-(3-phenylphenyl)phenyl]boronic acid
InChIKeyDGIXQQRYMQRZBZ-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CC=CC(=C2)C3=CC=CC=C3)(O)O

Computed by PubChem (NCBI)