Products 364050-45-3

CAS 364050-45-3 is the registry number for 2,4-(Diphenyl)phenylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,4-diphenylphenyl)boronic acid (CAS 364050-45-3) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: (2,4-diphenylphenyl)boronic acid. InChIKey: YBCUDQAIIXWIIR-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15BO2
Molecular weight274.1 g/mol
IUPAC name(2,4-diphenylphenyl)boronic acid
InChIKeyYBCUDQAIIXWIIR-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O

Computed by PubChem (NCBI)