CAS 364050-45-3 is the registry number for 2,4-(Diphenyl)phenylboronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,4-diphenylphenyl)boronic acid (CAS 364050-45-3) is a chemical compound with the molecular formula C18H15BO2 and a molecular weight of 274.1 g/mol. IUPAC name: (2,4-diphenylphenyl)boronic acid. InChIKey: YBCUDQAIIXWIIR-UHFFFAOYSA-N.
| Molecular formula | C18H15BO2 |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | (2,4-diphenylphenyl)boronic acid |
| InChIKey | YBCUDQAIIXWIIR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)