cas: 870837-46-0 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-3-ylmethanamine hydrochloride 98% (CAS 870837-46-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A635716-250mg |
| cas | 870837-46-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1076.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A635716 |
(3-phenylphenyl)methanamine;hydrochloride (CAS 870837-46-0) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: (3-phenylphenyl)methanamine;hydrochloride. InChIKey: LGGFUBODWRKTQL-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | (3-phenylphenyl)methanamine;hydrochloride |
| InChIKey | LGGFUBODWRKTQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)