CAS 400749-90-8 appears in our catalog under these names: 3-(3-Methylphenyl)aniline hydrochloride, 98%, 3'-Methyl-biphenyl-3-ylamine hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
3-(3-methylphenyl)aniline;hydrochloride (CAS 400749-90-8) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 3-(3-methylphenyl)aniline;hydrochloride. InChIKey: ZITYSZFWSXTYAW-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 3-(3-methylphenyl)aniline;hydrochloride |
| InChIKey | ZITYSZFWSXTYAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)