CAS 870837-46-0 appears in our catalog under these names: 3-Phenylbenzylamine hydrochloride, 95%, (3-Phenylphenyl)methanamine hydrochloride, 98%, 98%, 3-PHENYLBENZYLAMINE HCL, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3-phenylphenyl)methanamine;hydrochloride (CAS 870837-46-0) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: (3-phenylphenyl)methanamine;hydrochloride. InChIKey: LGGFUBODWRKTQL-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | (3-phenylphenyl)methanamine;hydrochloride |
| InChIKey | LGGFUBODWRKTQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)