Products 6317-57-3
CAS 6317-57-3 appears in our catalog under these names: 4-Benzylaniline hydrochloride, 95%, 4-Benzylaniline hydrochloride, 98%+,RG, 98%+,RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g.
4-benzylaniline;hydrochloride (CAS 6317-57-3) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 4-benzylaniline;hydrochloride. InChIKey: GQGXIDBMRPMPCD-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 4-benzylaniline;hydrochloride |
| InChIKey | GQGXIDBMRPMPCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-benzylaniline hydrochloride, 4-benzylaniline;hydrochloride, Benzenamine, 4-(phenylmethyl)-, hydrochloride, (4-benzylphenyl)amine hydrochloride, alpha-Phenyl-p-toluidine hydrochloride, p-Toluidine, alpha-phenyl-, hydrochloride, 4-benzylanilinehydrochloride, 4-benzylphenylamine, chloride, p-aminodiphenyl-methane hydrochloride