CAS 811842-54-3 is the registry number for 4'-Methyl-biphenyl-4-ylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-methylphenyl)aniline;hydrochloride (CAS 811842-54-3) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 4-(4-methylphenyl)aniline;hydrochloride. InChIKey: BHDHDZPUPWUCJR-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 4-(4-methylphenyl)aniline;hydrochloride |
| InChIKey | BHDHDZPUPWUCJR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)