[1,1'-Biphenyl]-4-carbonyl fluoride, 97%
cas: 2714-87-6 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4-carbonyl fluoride, 97% (CAS 2714-87-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1443042-100mg |
| cas | 2714-87-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 1772.12 Pln | |
| Ambeed | 25g | 6906.31 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 542.06 Pln | |
| BLDpharm | 5g | 1908.24 Pln | |
| BLDpharm | 25g | 7439.63 Pln | |
| Fluorochem | 5g | 1804.59 Pln | |
| Fluorochem | 25g | 6922.58 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-phenylbenzoyl fluoride (CAS 2714-87-6) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 4-phenylbenzoyl fluoride. InChIKey: LBBFCPWRSLIXNI-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 4-phenylbenzoyl fluoride |
| InChIKey | LBBFCPWRSLIXNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)F |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Biphenyl]-4-carbonyl fluoride, (1,1'-Biphenyl)-4-carbonyl fluoride, 4-phenylbenzoyl fluoride, [1,1 inverted exclamation marka-Biphenyl]-4-carbonyl fluoride, starbld0010783, 1,1'-Biphenyl]-4-carbonyl fluoride, [1,1a(2)-Biphenyl]-4-carbonyl fluoride, [1,1'-Biphenyl]-4-carbonyl fluoride - [B92306]