CAS 2714-87-6 appears in our catalog under these names: (1,1'-Biphenyl)-4-carbonyl fluoride, 95-<97%, (1,1'-Biphenyl)-4-carbonyl fluoride, ≥97-<99%, [1,1′-Biphenyl]-4-carbonyl fluoride, 95%, 95%, [1,1'-BIPHENYL]-4-CARBONYL FLUORIDE, 98%, [1,1'-Biphenyl]-4-carbonyl fluoride, 97%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 100mg, 250mg.
4-phenylbenzoyl fluoride (CAS 2714-87-6) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 4-phenylbenzoyl fluoride. InChIKey: LBBFCPWRSLIXNI-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 4-phenylbenzoyl fluoride |
| InChIKey | LBBFCPWRSLIXNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)F |
Computed by PubChem (NCBI)