[1,3]Dioxolo[4,5-f]isobenzofuran-5(7H)-one, 97%
cas: 4792-36-3 — see every product listed under this CAS number, including other names
[1,3]Dioxolo[4,5-f]isobenzofuran-5(7H)-one, 97% (CAS 4792-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A751369-100mg |
| cas | 4792-36-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| Ambeed | 5g | 1516.25 Pln | |
| Ambeed | 10g | 2595.38 Pln | |
| Ambeed | 25g | 5120.75 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 586.48 Pln | |
| BLDpharm | 5g | 1625.01 Pln | |
| BLDpharm | 10g | 2791.26 Pln | |
| BLDpharm | 25g | 5518.08 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5H-furo[3,4-f][1,3]benzodioxol-7-one (CAS 4792-36-3) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 5H-furo[3,4-f][1,3]benzodioxol-7-one. InChIKey: QIYDTIMMZOUCGL-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5H-furo[3,4-f][1,3]benzodioxol-7-one |
| InChIKey | QIYDTIMMZOUCGL-UHFFFAOYSA-N |
| SMILES | C1C2=CC3=C(C=C2C(=O)O1)OCO3 |
Computed by PubChem (NCBI)
![FURO[3,4-F]-1,3-BENZODIOXOL-5(7H)-ONE, 98%](https://cdn.chemat.com.pl/products/images/a4f2c54ecb074a4ec4d498a49520f637d737ac8595beb73b8eb20f233427cc1d.svg)