Products 487-56-9
CAS 487-56-9 appears in our catalog under these names: 4-Hydroxybenzofuran-5-carboxylic acid, 95%, 4-Hydroxybenzofuran-5-carboxylic acid, 98+%, 4–Hydroxybenzofuran–5–carboxylic acid, 4-hydroxy-5-Benzofurancarboxylic acid, 98%, 98%, 4-HYDROXYBENZOFURAN-5-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 500mg.
4-hydroxy-1-benzofuran-5-carboxylic acid (CAS 487-56-9) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 4-hydroxy-1-benzofuran-5-carboxylic acid. InChIKey: UCRGNGLRQIWOTB-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 4-hydroxy-1-benzofuran-5-carboxylic acid |
| InChIKey | UCRGNGLRQIWOTB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CO2)C(=C1C(=O)O)O |
Computed by PubChem (NCBI)