CAS 2227306-81-0 is the registry number for 5-Methoxybenzofuran-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-1-benzofuran-2,3-dione (CAS 2227306-81-0) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 5-methoxy-1-benzofuran-2,3-dione. InChIKey: VYEZBSHOVFTXCH-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-methoxy-1-benzofuran-2,3-dione |
| InChIKey | VYEZBSHOVFTXCH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=O)C2=O |
Computed by PubChem (NCBI)