CAS 4743-61-7 appears in our catalog under these names: 3-Oxo-1,3-dihydro-2-benzofuran-5-carboxylic acid, 95%, 3-Oxo-1,3-dihydroisobenzofuran-5-carboxylic acid, 97%, 3-Oxo-1,3-dihydroisobenzofuran-5-carboxylic acid, 3-Oxo-1,3-dihydroisobenzofuran-5-carboxylic acid, 97%, 97%, 3-OXO-1,3-DIHYDRO-2-BENZOFURAN-5-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 50mg, 500mg.
3-oxo-1H-2-benzofuran-5-carboxylic acid (CAS 4743-61-7) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 3-oxo-1H-2-benzofuran-5-carboxylic acid. InChIKey: VUBKPUVOSWVXMI-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-oxo-1H-2-benzofuran-5-carboxylic acid |
| InChIKey | VUBKPUVOSWVXMI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C(=O)O)C(=O)O1 |
Computed by PubChem (NCBI)