CAS 30992-75-7 appears in our catalog under these names: 4,6-Dihydroxycoumarin, 95%, 4,6-Dihydroxy-2H-chromen-2-one. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 10g, 250mg, 500mg.
4,6-dihydroxychromen-2-one (CAS 30992-75-7) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 4,6-dihydroxychromen-2-one. InChIKey: ORMYACLDZGAWNY-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 4,6-dihydroxychromen-2-one |
| InChIKey | ORMYACLDZGAWNY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CC(=O)O2)O |
Computed by PubChem (NCBI)