cas: 5421-92-1 — see every product listed under this CAS number, including other names
[1,4'-Bipyridin]-1-ium chloride hydrochloride, 98% (CAS 5421-92-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242703-25G |
| cas | 5421-92-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1164.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride (CAS 5421-92-1) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride. InChIKey: QZOFFMRDIRXGKJ-UHFFFAOYSA-M.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride |
| InChIKey | QZOFFMRDIRXGKJ-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)C2=CC=NC=C2.Cl.[Cl-] |
Computed by PubChem (NCBI)