CAS 31079-46-6 is the registry number for N-(3,4-Dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,4-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine (CAS 31079-46-6) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine. InChIKey: QJYDWXXPXYARJI-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| InChIKey | QJYDWXXPXYARJI-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)