CAS 3237-62-5 appears in our catalog under these names: 5,6-Dichloro-1-ethyl-2-methylbenzimidazole, 95%, 5,6–Dichloro–1–ethyl–2–methylbenzimidazole, 1-Ethyl-2-methyl-5,6-dichlorobenzimidazole, 5,6-Dichloro-1-ethyl-2-methylbenzimidazole, >98.0%(HPLC)(T), 5,6-Dichloro-1-ethyl-2-methyl-1H-benzo[d]imidazole 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 1g, 2g, 10g, 50g, 25g, 100mg, 250mg.
5,6-dichloro-1-ethyl-2-methylbenzimidazole (CAS 3237-62-5) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 5,6-dichloro-1-ethyl-2-methylbenzimidazole. InChIKey: IVVLMQPTQOLYDX-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 5,6-dichloro-1-ethyl-2-methylbenzimidazole |
| InChIKey | IVVLMQPTQOLYDX-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=CC(=C(C=C21)Cl)Cl)C |
Computed by PubChem (NCBI)