CAS 202823-67-4 appears in our catalog under these names: 1,4-Dichloro-5,6,7,8-tetrahydro-5,8-ethanophthalazine, 95%, 1,4-Dichloro-5,6,7,8-tetrahydro-5,8-ethanophthalazine, 97% , 1,4-Dichloro-5,6,7,8-tetrahydro-5,8-ethanophthalazine, ≥97%, ≥97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3,6-dichloro-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (CAS 202823-67-4) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 3,6-dichloro-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene. InChIKey: GZIFYLGNTOAIJJ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 3,6-dichloro-4,5-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| InChIKey | GZIFYLGNTOAIJJ-UHFFFAOYSA-N |
| SMILES | C1CC2CCC1C3=C2C(=NN=C3Cl)Cl |
Computed by PubChem (NCBI)