cas: 5421-92-1 — see every product listed under this CAS number, including other names
[1,4-Bipyridin]-1-ium chloride hydrochloride 98% (CAS 5421-92-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A705112-25g |
| cas | 5421-92-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1176.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A705112 |
4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride (CAS 5421-92-1) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride. InChIKey: QZOFFMRDIRXGKJ-UHFFFAOYSA-M.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride |
| InChIKey | QZOFFMRDIRXGKJ-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)C2=CC=NC=C2.Cl.[Cl-] |
Computed by PubChem (NCBI)