cas: 148332-36-9 — see every product listed under this CAS number, including other names
[2,2':6',2''-Terpyridine]-4'-carboxylic acid, 95%, 95% (CAS 148332-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F03-100mg |
| cas | 148332-36-9 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 10g | 822.80 Pln | |
| Chemat | 25g | 1686.80 Pln | |
| Chemat | 100g | 5262.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dipyridin-2-ylpyridine-4-carboxylic acid (CAS 148332-36-9) is a chemical compound with the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. IUPAC name: 2,6-dipyridin-2-ylpyridine-4-carboxylic acid. InChIKey: ZYTWXMBGOUJDHJ-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O2 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 2,6-dipyridin-2-ylpyridine-4-carboxylic acid |
| InChIKey | ZYTWXMBGOUJDHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C(=O)O |
Computed by PubChem (NCBI)