Products 784193-47-1

CAS 784193-47-1 is the registry number for 2-(1H-Indazol-3-yl)-1h-indole-6-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(1H-indazol-3-yl)-1H-indole-6-carboxylic acid (CAS 784193-47-1) is a chemical compound with the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. IUPAC name: 2-(1H-indazol-3-yl)-1H-indole-6-carboxylic acid. InChIKey: LGCYYLQERLQEPI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11N3O2
Molecular weight277.28 g/mol
IUPAC name2-(1H-indazol-3-yl)-1H-indole-6-carboxylic acid
InChIKeyLGCYYLQERLQEPI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NN2)C3=CC4=C(N3)C=C(C=C4)C(=O)O

Computed by PubChem (NCBI)