CAS 116450-83-0 appears in our catalog under these names: 4-((6-Nitro-1h-indol-1-yl)methyl)benzonitrile, 95%, 4-((6-Nitro-1H-indol-1-yl)methyl)benzonitrile, 95+%, 4–((6–Nitro–1H–Indol–1–Yl)Methyl)Benzonitrile. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-[(6-nitroindol-1-yl)methyl]benzonitrile (CAS 116450-83-0) is a chemical compound with the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. IUPAC name: 4-[(6-nitroindol-1-yl)methyl]benzonitrile. InChIKey: OECLIUQCXNYUQS-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O2 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 4-[(6-nitroindol-1-yl)methyl]benzonitrile |
| InChIKey | OECLIUQCXNYUQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2CC3=CC=C(C=C3)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)