CAS 713514-91-1 appears in our catalog under these names: 2-Amino-4-(5-methylfuran-2-yl)-5H-indeno(1,2-d)pyrimidin-5-one, 95+%, 2-Amino-4-(5-methylfuran-2-yl)-5H-indeno(1,2-d)pyrimidin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-4-(5-methylfuran-2-yl)indeno[1,2-d]pyrimidin-5-one (CAS 713514-91-1) is a chemical compound with the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. IUPAC name: 2-amino-4-(5-methylfuran-2-yl)indeno[1,2-d]pyrimidin-5-one. InChIKey: DRMTXINYZBZWHW-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O2 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 2-amino-4-(5-methylfuran-2-yl)indeno[1,2-d]pyrimidin-5-one |
| InChIKey | DRMTXINYZBZWHW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=NC(=NC3=C2C(=O)C4=CC=CC=C43)N |
Computed by PubChem (NCBI)