CAS 938185-06-9 appears in our catalog under these names: Erlotinib Impurity 10, Erlotinib Impurity 46, Erlotinib Impurity 17. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-(3-ethynylanilino)quinazoline-6,7-diol (CAS 938185-06-9) is a chemical compound with the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. IUPAC name: 4-(3-ethynylanilino)quinazoline-6,7-diol. InChIKey: CXKGQADVJHFOTJ-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O2 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 4-(3-ethynylanilino)quinazoline-6,7-diol |
| InChIKey | CXKGQADVJHFOTJ-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC2=NC=NC3=CC(=C(C=C32)O)O |
Computed by PubChem (NCBI)