CAS 68500-41-4 appears in our catalog under these names: 4-Hydrazinoquinoline hydrochloride, 4-Hydrazinoquinoline hydrochloride, 95%, 4-Hydrazinylquinoline hydrochloride, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 250mg.
Quinolin-4-ylhydrazine;hydrochloride (CAS 68500-41-4) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: quinolin-4-ylhydrazine;hydrochloride. InChIKey: WRAUKLFJWHVIGP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | quinolin-4-ylhydrazine;hydrochloride |
| InChIKey | WRAUKLFJWHVIGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)NN.Cl |
Computed by PubChem (NCBI)