CAS 1262773-91-0 is the registry number for [2-(1H-Imidazol-1-yl)phenyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
2-imidazol-1-ylaniline;hydrochloride (CAS 1262773-91-0) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 2-imidazol-1-ylaniline;hydrochloride. InChIKey: APTDXVXTLJBUFI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 2-imidazol-1-ylaniline;hydrochloride |
| InChIKey | APTDXVXTLJBUFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N2C=CN=C2.Cl |
Computed by PubChem (NCBI)