CAS 63468-94-0 is the registry number for 2-(Quinolin-3-yl)hydrazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Quinolin-3-ylhydrazine;hydrochloride (CAS 63468-94-0) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: quinolin-3-ylhydrazine;hydrochloride. InChIKey: BOJSQUHIRFMBLP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | quinolin-3-ylhydrazine;hydrochloride |
| InChIKey | BOJSQUHIRFMBLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)NN.Cl |
Computed by PubChem (NCBI)