[2-FLUORO-4-(TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]ACETIC ACID, 96%, 96%
cas: 1431546-20-1 — see every product listed under this CAS number, including other names
[2-FLUORO-4-(TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]ACETIC ACID, 96%, 96% (CAS 1431546-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWTC-100mg |
| cas | 1431546-20-1 |
| size | 100mg |
| availability | 30g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2402.00 Pln | |
| Chemat | 10g | 3803.60 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (CAS 1431546-20-1) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid. InChIKey: QXMBNFNHXUBERX-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| InChIKey | QXMBNFNHXUBERX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CC(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
[2-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid, 2-(2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid, 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid, [2-Fluoro-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenyl]-acetic acid, 2-Fluorophenylacetic acid-4-boronic acid pinacol ester, (2-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid, QXMBNFNHXUBERX-UHFFFAOYSA-N, 4-(Carboxymethyl)-3-fluorophenylboronic Acid Pinacol Ester, [2-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aceticacid